C19H25N5O5S — CID 17066812
N-[3-(4-nitroanilino)propyl]-2-[2-(4-sulfamoylphenyl)ethylamino]acetamide (PubChem CID 17066812) has the molecular formula C19H25N5O5S and a molecular weight of 435.51 g/mol. Its IUPAC name is N-[3-(4-nitroanilino)propyl]-2-[2-(4-sulfamoylphenyl)ethylamino]acetamide.
| Compound Name | N-[3-(4-nitroanilino)propyl]-2-[2-(4-sulfamoylphenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 17066812 |
| Molecular Formula | C19H25N5O5S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[3-(4-nitroanilino)propyl]-2-[2-(4-sulfamoylphenyl)ethylamino]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CCNCC(=O)NCCCNc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H25N5O5S/c20-30(28,29)18-8-2-15(3-9-18)10-13-21-14-19(25)23-12-1-11-22-16-4-6-17(7-5-16)24(26)27/h2-9,21-22H,1,10-14H2,(H,23,25)(H2,20,28,29) |
| InChIKey | UGQXWYZDSHCJLZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|