C58H67NO2 — CID 170668304
2-(1-adamantyl)-6-[2-[6-[2-[3-(1-adamantyl)-5-tert-butyl-2-hydroxyphenyl]phenyl]-1-methylidenepyridin-1-ium-2-id-2-yl]phenyl]-4-tert-butylphenol (PubChem CID 170668304) has the molecular formula C58H67NO2 and a molecular weight of 810.18 g/mol. Its IUPAC name is 2-(1-adamantyl)-6-[2-[6-[2-[3-(1-adamantyl)-5-tert-butyl-2-hydroxyphenyl]phenyl]-1-methylidenepyridin-1-ium-2-id-2-yl]phenyl]-4-tert-butylphenol.
| Compound Name | 2-(1-adamantyl)-6-[2-[6-[2-[3-(1-adamantyl)-5-tert-butyl-2-hydroxyphenyl]phenyl]-1-methylidenepyridin-1-ium-2-id-2-yl]phenyl]-4-tert-butylphenol |
|---|---|
| PubChem CID | 170668304 |
| Molecular Formula | C58H67NO2 |
| Molecular Weight | 810.18 g/mol |
| Exact Mass | 809.52 |
| IUPAC Name | 2-(1-adamantyl)-6-[2-[6-[2-[3-(1-adamantyl)-5-tert-butyl-2-hydroxyphenyl]phenyl]-1-methylidenepyridin-1-ium-2-id-2-yl]phenyl]-4-tert-butylphenol |
| SMILES | C=[N+]1C(c2ccccc2-c2cc(C(C)(C)C)cc(C34CC5CC(CC(C5)C3)C4)c2O)=CC=C[C-]1c1ccccc1-c1cc(C(C)(C)C)cc(C23CC4CC(CC(C4)C2)C3)c1O |
| InChI | InChI=1S/C58H67NO2/c1-55(2,3)41-25-47(53(60)49(27-41)57-29-35-19-36(30-57)21-37(20-35)31-57)43-13-8-10-15-45(43)51-17-12-18-52(59(51)7)46-16-11-9-14-44(46)48-26-42(56(4,5)6)28-50(54(48)61)58-32-38-22-39(33-58)24-40(23-38)34-58/h8-18,25-28,35-40,60-61H,7,19-24,29-34H2,1-6H3 |
| InChIKey | WMQUTPRBMPBBIH-UHFFFAOYSA-N |
| XLogP | 14.17 |
| TPSA | 43.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.18 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|