C21H46NO10+ — CID 170672450
2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl-bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-methylazanium (PubChem CID 170672450) has the molecular formula C21H46NO10+ and a molecular weight of 472.60 g/mol. Its IUPAC name is 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl-bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-methylazanium.
| Compound Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl-bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-methylazanium |
|---|---|
| PubChem CID | 170672450 |
| Molecular Formula | C21H46NO10+ |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl-bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-methylazanium |
| SMILES | C[N+](CCOCCOCCO)(CCOCCOCCO)CCOCCOCCOCCO |
| InChI | InChI=1S/C21H46NO10/c1-22(2-8-26-14-17-29-11-5-23,3-9-27-15-18-30-12-6-24)4-10-28-16-20-32-21-19-31-13-7-25/h23-25H,2-21H2,1H3/q+1 |
| InChIKey | DGKAHKWOIOMOIS-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|