C16H38N2O4+2 — CID 132605784
3-hydroxypropyl-[2-[2-[2-[3-hydroxypropyl(dimethyl)azaniumyl]ethoxy]ethoxy]ethyl]-dimethylazanium (PubChem CID 132605784) has the molecular formula C16H38N2O4+2 and a molecular weight of 322.49 g/mol. Its IUPAC name is 3-hydroxypropyl-[2-[2-[2-[3-hydroxypropyl(dimethyl)azaniumyl]ethoxy]ethoxy]ethyl]-dimethylazanium.
| Compound Name | 3-hydroxypropyl-[2-[2-[2-[3-hydroxypropyl(dimethyl)azaniumyl]ethoxy]ethoxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 132605784 |
| Molecular Formula | C16H38N2O4+2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.28 |
| IUPAC Name | 3-hydroxypropyl-[2-[2-[2-[3-hydroxypropyl(dimethyl)azaniumyl]ethoxy]ethoxy]ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCO)CCOCCOCC[N+](C)(C)CCCO |
| InChI | InChI=1S/C16H38N2O4/c1-17(2,7-5-11-19)9-13-21-15-16-22-14-10-18(3,4)8-6-12-20/h19-20H,5-16H2,1-4H3/q+2 |
| InChIKey | DZVYTMUEDOGOGJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|