C30H28O4 — CID 170674052
(4-benzoyloxy-5-phenyl-3-tricyclo[5.2.1.02,6]decanyl) benzoate (PubChem CID 170674052) has the molecular formula C30H28O4 and a molecular weight of 452.55 g/mol. Its IUPAC name is (4-benzoyloxy-5-phenyl-3-tricyclo[5.2.1.02,6]decanyl) benzoate.
| Compound Name | (4-benzoyloxy-5-phenyl-3-tricyclo[5.2.1.02,6]decanyl) benzoate |
|---|---|
| PubChem CID | 170674052 |
| Molecular Formula | C30H28O4 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (4-benzoyloxy-5-phenyl-3-tricyclo[5.2.1.02,6]decanyl) benzoate |
| SMILES | O=C(OC1C(OC(=O)c2ccccc2)C2C3CCC(C3)C2C1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28O4/c31-29(20-12-6-2-7-13-20)33-27-25(19-10-4-1-5-11-19)24-22-16-17-23(18-22)26(24)28(27)34-30(32)21-14-8-3-9-15-21/h1-15,22-28H,16-18H2 |
| InChIKey | OVHNUHWETVRXAD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |