C42H46O4 — CID 170674139
[(1S,8S)-16-benzoyloxy-3,6,10-tritert-butyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaenyl] benzoate (PubChem CID 170674139) has the molecular formula C42H46O4 and a molecular weight of 614.83 g/mol. Its IUPAC name is [(1S,8S)-16-benzoyloxy-3,6,10-tritert-butyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaenyl] benzoate.
| Compound Name | [(1S,8S)-16-benzoyloxy-3,6,10-tritert-butyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaenyl] benzoate |
|---|---|
| PubChem CID | 170674139 |
| Molecular Formula | C42H46O4 |
| Molecular Weight | 614.83 g/mol |
| Exact Mass | 614.34 |
| IUPAC Name | [(1S,8S)-16-benzoyloxy-3,6,10-tritert-butyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaenyl] benzoate |
| SMILES | CC(C)(C)c1cccc2c1[C@H]1c3c(C(C)(C)C)ccc(C(C)(C)C)c3[C@H]2C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C42H46O4/c1-40(2,3)28-22-16-21-27-31(28)35-34-30(42(7,8)9)24-23-29(41(4,5)6)33(34)32(27)36(45-38(43)25-17-12-10-13-18-25)37(35)46-39(44)26-19-14-11-15-20-26/h10-24,32,35-37H,1-9H3/t32-,35-,36?,37?/m0/s1 |
| InChIKey | GWWVJYAHTCJCGN-UCRVEASKSA-N |
| XLogP | 9.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.83 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |