C9H9F3 — CID 170676987
1,4-dideuterio-2,3,5-trifluoro-6-propan-2-ylbenzene (PubChem CID 170676987) has the molecular formula C9H9F3 and a molecular weight of 176.18 g/mol. Its IUPAC name is 1,4-dideuterio-2,3,5-trifluoro-6-propan-2-ylbenzene.
| Compound Name | 1,4-dideuterio-2,3,5-trifluoro-6-propan-2-ylbenzene |
|---|---|
| PubChem CID | 170676987 |
| Molecular Formula | C9H9F3 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1,4-dideuterio-2,3,5-trifluoro-6-propan-2-ylbenzene |
| SMILES | [2H]c1c(F)c(F)c([2H])c(C(C)C)c1F |
| InChI | InChI=1S/C9H9F3/c1-5(2)6-3-8(11)9(12)4-7(6)10/h3-5H,1-2H3/i3D,4D |
| InChIKey | ZSENERLFZXSGHI-NMQOAUCRSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|