C28H33ClF2N8O2S — CID 170680694
3-[[2-[4-[4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]piperidin-1-yl]-2-(difluoromethoxy)anilino]-5-chloropyrimidin-4-yl]amino]thiophene-2-carboxamide (PubChem CID 170680694) has the molecular formula C28H33ClF2N8O2S and a molecular weight of 619.14 g/mol. Its IUPAC name is 3-[[2-[4-[4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]piperidin-1-yl]-2-(difluoromethoxy)anilino]-5-chloropyrimidin-4-yl]amino]thiophene-2-carboxamide.
| Compound Name | 3-[[2-[4-[4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]piperidin-1-yl]-2-(difluoromethoxy)anilino]-5-chloropyrimidin-4-yl]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 170680694 |
| Molecular Formula | C28H33ClF2N8O2S |
| Molecular Weight | 619.14 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | 3-[[2-[4-[4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]piperidin-1-yl]-2-(difluoromethoxy)anilino]-5-chloropyrimidin-4-yl]amino]thiophene-2-carboxamide |
| SMILES | NC(=O)c1sccc1Nc1nc(Nc2ccc(N3CCC(N4CCN5CCC[C@@H]5C4)CC3)cc2OC(F)F)ncc1Cl |
| InChI | InChI=1S/C28H33ClF2N8O2S/c29-20-15-33-28(36-26(20)34-22-7-13-42-24(22)25(32)40)35-21-4-3-18(14-23(21)41-27(30)31)38-9-5-17(6-10-38)39-12-11-37-8-1-2-19(37)16-39/h3-4,7,13-15,17,19,27H,1-2,5-6,8-12,16H2,(H2,32,40)(H2,33,34,35,36)/t19-/m1/s1 |
| InChIKey | LCTHVGNMXFULTF-LJQANCHMSA-N |
| XLogP | 5.13 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.14 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |