C23H24ClF2N7O2S — CID 170680751
3-[[2-[4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(difluoromethoxy)anilino]-5-chloropyrimidin-4-yl]amino]thiophene-2-carboxamide (PubChem CID 170680751) has the molecular formula C23H24ClF2N7O2S and a molecular weight of 536.01 g/mol. Its IUPAC name is 3-[[2-[4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(difluoromethoxy)anilino]-5-chloropyrimidin-4-yl]amino]thiophene-2-carboxamide.
| Compound Name | 3-[[2-[4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(difluoromethoxy)anilino]-5-chloropyrimidin-4-yl]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 170680751 |
| Molecular Formula | C23H24ClF2N7O2S |
| Molecular Weight | 536.01 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 3-[[2-[4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(difluoromethoxy)anilino]-5-chloropyrimidin-4-yl]amino]thiophene-2-carboxamide |
| SMILES | NC(=O)c1sccc1Nc1nc(Nc2ccc(N3CCN4CCC[C@@H]4C3)cc2OC(F)F)ncc1Cl |
| InChI | InChI=1S/C23H24ClF2N7O2S/c24-15-11-28-23(31-21(15)29-17-5-9-36-19(17)20(27)34)30-16-4-3-13(10-18(16)35-22(25)26)33-8-7-32-6-1-2-14(32)12-33/h3-5,9-11,14,22H,1-2,6-8,12H2,(H2,27,34)(H2,28,29,30,31)/t14-/m1/s1 |
| InChIKey | PVRKFDZVABSHHY-CQSZACIVSA-N |
| XLogP | 4.66 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.01 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |