C11H6F6O5 — CID 170682092
2-(trifluoromethoxy)-3-(3,3,3-trifluoropropanoyloxy)benzoic acid (PubChem CID 170682092) has the molecular formula C11H6F6O5 and a molecular weight of 332.15 g/mol. Its IUPAC name is 2-(trifluoromethoxy)-3-(3,3,3-trifluoropropanoyloxy)benzoic acid.
| Compound Name | 2-(trifluoromethoxy)-3-(3,3,3-trifluoropropanoyloxy)benzoic acid |
|---|---|
| PubChem CID | 170682092 |
| Molecular Formula | C11H6F6O5 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 2-(trifluoromethoxy)-3-(3,3,3-trifluoropropanoyloxy)benzoic acid |
| SMILES | O=C(CC(F)(F)F)Oc1cccc(C(=O)O)c1OC(F)(F)F |
| InChI | InChI=1S/C11H6F6O5/c12-10(13,14)4-7(18)21-6-3-1-2-5(9(19)20)8(6)22-11(15,16)17/h1-3H,4H2,(H,19,20) |
| InChIKey | KIBMAWNGOZEYEN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|