C11H5F6O5- — CID 170682091
2-(trifluoromethoxy)-3-(3,3,3-trifluoropropanoyloxy)benzoate (PubChem CID 170682091) has the molecular formula C11H5F6O5- and a molecular weight of 331.14 g/mol. Its IUPAC name is 2-(trifluoromethoxy)-3-(3,3,3-trifluoropropanoyloxy)benzoate.
| Compound Name | 2-(trifluoromethoxy)-3-(3,3,3-trifluoropropanoyloxy)benzoate |
|---|---|
| PubChem CID | 170682091 |
| Molecular Formula | C11H5F6O5- |
| Molecular Weight | 331.14 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 2-(trifluoromethoxy)-3-(3,3,3-trifluoropropanoyloxy)benzoate |
| SMILES | O=C(CC(F)(F)F)Oc1cccc(C(=O)[O-])c1OC(F)(F)F |
| InChI | InChI=1S/C11H6F6O5/c12-10(13,14)4-7(18)21-6-3-1-2-5(9(19)20)8(6)22-11(15,16)17/h1-3H,4H2,(H,19,20)/p-1 |
| InChIKey | KIBMAWNGOZEYEN-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.14 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|