C10H8F3O3S- — CID 170682154
2-ethoxy-3-(trifluoromethylsulfanyl)benzoate (PubChem CID 170682154) has the molecular formula C10H8F3O3S- and a molecular weight of 265.23 g/mol. Its IUPAC name is 2-ethoxy-3-(trifluoromethylsulfanyl)benzoate.
| Compound Name | 2-ethoxy-3-(trifluoromethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 170682154 |
| Molecular Formula | C10H8F3O3S- |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-ethoxy-3-(trifluoromethylsulfanyl)benzoate |
| SMILES | CCOc1c(SC(F)(F)F)cccc1C(=O)[O-] |
| InChI | InChI=1S/C10H9F3O3S/c1-2-16-8-6(9(14)15)4-3-5-7(8)17-10(11,12)13/h3-5H,2H2,1H3,(H,14,15)/p-1 |
| InChIKey | NJCQQENEDBURIF-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |