C20H14BrF6NO — CID 170683396
1-[3,5-bis(trifluoromethyl)phenyl]-2-(6-methylquinolin-1-ium-1-yl)ethanone bromide (PubChem CID 170683396) has the molecular formula C20H14BrF6NO and a molecular weight of 478.23 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-2-(6-methylquinolin-1-ium-1-yl)ethanone bromide.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-(6-methylquinolin-1-ium-1-yl)ethanone bromide |
|---|---|
| PubChem CID | 170683396 |
| Molecular Formula | C20H14BrF6NO |
| Molecular Weight | 478.23 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-(6-methylquinolin-1-ium-1-yl)ethanone bromide |
| SMILES | Cc1ccc2c(ccc[n+]2CC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1.[Br-] |
| InChI | InChI=1S/C20H14F6NO.BrH/c1-12-4-5-17-13(7-12)3-2-6-27(17)11-18(28)14-8-15(19(21,22)23)10-16(9-14)20(24,25)26;/h2-10H,11H2,1H3;1H/q+1;/p-1 |
| InChIKey | MFLOPGLKALBBKO-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|