C25H19F3N3O2+ — CID 90486707
1-[4-(2-quinolin-1-ium-1-ylacetyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 90486707) has the molecular formula C25H19F3N3O2+ and a molecular weight of 450.44 g/mol. Its IUPAC name is 1-[4-(2-quinolin-1-ium-1-ylacetyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(2-quinolin-1-ium-1-ylacetyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90486707 |
| Molecular Formula | C25H19F3N3O2+ |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 1-[4-(2-quinolin-1-ium-1-ylacetyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(=O)C[n+]2cccc3ccccc32)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H18F3N3O2/c26-25(27,28)19-7-3-8-21(15-19)30-24(33)29-20-12-10-18(11-13-20)23(32)16-31-14-4-6-17-5-1-2-9-22(17)31/h1-15H,16H2,(H-,29,30,32,33)/p+1 |
| InChIKey | MOSWHDMUIZTVMW-UHFFFAOYSA-O |
| XLogP | 5.67 |
| TPSA | 62.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|