C25H25F3N3O2+ — CID 90486722
1-[4-[2-(4-tert-butylpyridin-1-ium-1-yl)acetyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 90486722) has the molecular formula C25H25F3N3O2+ and a molecular weight of 456.49 g/mol. Its IUPAC name is 1-[4-[2-(4-tert-butylpyridin-1-ium-1-yl)acetyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[2-(4-tert-butylpyridin-1-ium-1-yl)acetyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90486722 |
| Molecular Formula | C25H25F3N3O2+ |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 1-[4-[2-(4-tert-butylpyridin-1-ium-1-yl)acetyl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CC(C)(C)c1cc[n+](CC(=O)c2ccc(NC(=O)Nc3cccc(C(F)(F)F)c3)cc2)cc1 |
| InChI | InChI=1S/C25H24F3N3O2/c1-24(2,3)18-11-13-31(14-12-18)16-22(32)17-7-9-20(10-8-17)29-23(33)30-21-6-4-5-19(15-21)25(26,27)28/h4-15H,16H2,1-3H3,(H-,29,30,32,33)/p+1 |
| InChIKey | HJUUWEMKJTZAOY-UHFFFAOYSA-O |
| XLogP | 5.82 |
| TPSA | 62.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|