C23H28F3O4- — CID 170686152
3-[2,2-dimethyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-4-(trifluoromethyl)benzoate (PubChem CID 170686152) has the molecular formula C23H28F3O4- and a molecular weight of 425.47 g/mol. Its IUPAC name is 3-[2,2-dimethyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-4-(trifluoromethyl)benzoate.
| Compound Name | 3-[2,2-dimethyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 170686152 |
| Molecular Formula | C23H28F3O4- |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-[2,2-dimethyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]-4-(trifluoromethyl)benzoate |
| SMILES | CC(C)(C)C(Oc1cc(C(=O)[O-])ccc1C(F)(F)F)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C23H29F3O4/c1-22(2,3)21(29-18-11-13-9-16(18)15-6-4-5-14(13)15)30-19-10-12(20(27)28)7-8-17(19)23(24,25)26/h7-8,10,13-16,18,21H,4-6,9,11H2,1-3H3,(H,27,28)/p-1 |
| InChIKey | OVELNUVOVCCTDZ-UHFFFAOYSA-M |
| XLogP | 4.66 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|