C18H20FO4- — CID 170686256
4-fluoro-3-(8-tricyclo[5.2.1.02,6]decanyloxymethoxy)benzoate (PubChem CID 170686256) has the molecular formula C18H20FO4- and a molecular weight of 319.35 g/mol. Its IUPAC name is 4-fluoro-3-(8-tricyclo[5.2.1.02,6]decanyloxymethoxy)benzoate.
| Compound Name | 4-fluoro-3-(8-tricyclo[5.2.1.02,6]decanyloxymethoxy)benzoate |
|---|---|
| PubChem CID | 170686256 |
| Molecular Formula | C18H20FO4- |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4-fluoro-3-(8-tricyclo[5.2.1.02,6]decanyloxymethoxy)benzoate |
| SMILES | O=C([O-])c1ccc(F)c(OCOC2CC3CC2C2CCCC32)c1 |
| InChI | InChI=1S/C18H21FO4/c19-15-5-4-10(18(20)21)7-17(15)23-9-22-16-8-11-6-14(16)13-3-1-2-12(11)13/h4-5,7,11-14,16H,1-3,6,8-9H2,(H,20,21)/p-1 |
| InChIKey | ZRONYGMNCFJNCV-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|