C21H24F3O4- — CID 170686332
3-[2-(8-tricyclo[5.2.1.02,6]decanyloxy)propan-2-yloxy]-4-(trifluoromethyl)benzoate (PubChem CID 170686332) has the molecular formula C21H24F3O4- and a molecular weight of 397.41 g/mol. Its IUPAC name is 3-[2-(8-tricyclo[5.2.1.02,6]decanyloxy)propan-2-yloxy]-4-(trifluoromethyl)benzoate.
| Compound Name | 3-[2-(8-tricyclo[5.2.1.02,6]decanyloxy)propan-2-yloxy]-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 170686332 |
| Molecular Formula | C21H24F3O4- |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 3-[2-(8-tricyclo[5.2.1.02,6]decanyloxy)propan-2-yloxy]-4-(trifluoromethyl)benzoate |
| SMILES | CC(C)(Oc1cc(C(=O)[O-])ccc1C(F)(F)F)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C21H25F3O4/c1-20(2,27-17-10-12-8-15(17)14-5-3-4-13(12)14)28-18-9-11(19(25)26)6-7-16(18)21(22,23)24/h6-7,9,12-15,17H,3-5,8,10H2,1-2H3,(H,25,26)/p-1 |
| InChIKey | YHJDWSHMLPDLOM-UHFFFAOYSA-M |
| XLogP | 4.03 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|