C24H35F3OS — CID 170688963
1-[11-(3-propan-2-yloxypropylsulfanyl)undec-1-ynyl]-4-(trifluoromethyl)benzene (PubChem CID 170688963) has the molecular formula C24H35F3OS and a molecular weight of 428.60 g/mol. Its IUPAC name is 1-[11-(3-propan-2-yloxypropylsulfanyl)undec-1-ynyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[11-(3-propan-2-yloxypropylsulfanyl)undec-1-ynyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 170688963 |
| Molecular Formula | C24H35F3OS |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1-[11-(3-propan-2-yloxypropylsulfanyl)undec-1-ynyl]-4-(trifluoromethyl)benzene |
| SMILES | CC(C)OCCCSCCCCCCCCCC#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H35F3OS/c1-21(2)28-18-12-20-29-19-11-9-7-5-3-4-6-8-10-13-22-14-16-23(17-15-22)24(25,26)27/h14-17,21H,3-9,11-12,18-20H2,1-2H3 |
| InChIKey | SRLQMAIOESNGNG-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|