C26H42OS — CID 170689118
1-tert-butyl-4-[10-(3-propan-2-yloxypropylsulfanyl)dec-1-ynyl]benzene (PubChem CID 170689118) has the molecular formula C26H42OS and a molecular weight of 402.69 g/mol. Its IUPAC name is 1-tert-butyl-4-[10-(3-propan-2-yloxypropylsulfanyl)dec-1-ynyl]benzene.
| Compound Name | 1-tert-butyl-4-[10-(3-propan-2-yloxypropylsulfanyl)dec-1-ynyl]benzene |
|---|---|
| PubChem CID | 170689118 |
| Molecular Formula | C26H42OS |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 1-tert-butyl-4-[10-(3-propan-2-yloxypropylsulfanyl)dec-1-ynyl]benzene |
| SMILES | CC(C)OCCCSCCCCCCCCC#Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H42OS/c1-23(2)27-20-14-22-28-21-13-11-9-7-6-8-10-12-15-24-16-18-25(19-17-24)26(3,4)5/h16-19,23H,6-11,13-14,20-22H2,1-5H3 |
| InChIKey | ZAAWZZWSWLKOIJ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|