C22H46OS — CID 170689103
1,1,1,2,2-pentadeuterio-16-(3-propan-2-yloxypropylsulfanyl)hexadecane (PubChem CID 170689103) has the molecular formula C22H46OS and a molecular weight of 363.71 g/mol. Its IUPAC name is 1,1,1,2,2-pentadeuterio-16-(3-propan-2-yloxypropylsulfanyl)hexadecane.
| Compound Name | 1,1,1,2,2-pentadeuterio-16-(3-propan-2-yloxypropylsulfanyl)hexadecane |
|---|---|
| PubChem CID | 170689103 |
| Molecular Formula | C22H46OS |
| Molecular Weight | 363.71 g/mol |
| Exact Mass | 363.36 |
| IUPAC Name | 1,1,1,2,2-pentadeuterio-16-(3-propan-2-yloxypropylsulfanyl)hexadecane |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CCCCCCCCCCCCCCSCCCOC(C)C |
| InChI | InChI=1S/C22H46OS/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-24-21-18-19-23-22(2)3/h22H,4-21H2,1-3H3/i1D3,4D2 |
| InChIKey | GEDQHBPLJKUYEG-SGEUAGPISA-N |
| XLogP | 8.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.71 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|