About 3-propan-2-yloxypropyl thiohypofluorite
3-propan-2-yloxypropyl thiohypofluorite (PubChem CID 146245926) has the molecular formula C6H13FOS
and a molecular weight of 152.23 g/mol. Its IUPAC name is 3-propan-2-yloxypropyl thiohypofluorite.
Molecular Properties
| Compound Name | 3-propan-2-yloxypropyl thiohypofluorite |
| PubChem CID | 146245926 |
| Molecular Formula | C6H13FOS |
| Molecular Weight | 152.23 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 3-propan-2-yloxypropyl thiohypofluorite |
| SMILES | CC(C)OCCCSF |
| InChI | InChI=1S/C6H13FOS/c1-6(2)8-4-3-5-9-7/h6H,3-5H2,1-2H3 |
| InChIKey | KATDLVHSULJDCM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-propan-2-yloxypropyl thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yloxypropyl thiohypofluorite?
The IUPAC name of 3-propan-2-yloxypropyl thiohypofluorite (CID 146245926) is 3-propan-2-yloxypropyl thiohypofluorite.
What is the SMILES notation for 3-propan-2-yloxypropyl thiohypofluorite?
The canonical SMILES for 3-propan-2-yloxypropyl thiohypofluorite is CC(C)OCCCSF.
What is the InChIKey of 3-propan-2-yloxypropyl thiohypofluorite?
The InChIKey is KATDLVHSULJDCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13FOS/c1-6(2)8-4-3-5-9-7/h6H,3-5H2,1-2H3.
What are the key properties of 3-propan-2-yloxypropyl thiohypofluorite?
3-propan-2-yloxypropyl thiohypofluorite has a molecular weight of 152.23 g/mol, XLogP of 2.42, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yloxypropyl thiohypofluorite is sourced from PubChem (CID 146245926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).