C64H68N2 — CID 170691771
10-[10-[9,9-dimethyl-2,7-bis(2-methylbut-3-en-2-yl)acridin-10-yl]anthracen-9-yl]-9,9-dimethyl-2,7-bis(2-methylbut-3-en-2-yl)acridine (PubChem CID 170691771) has the molecular formula C64H68N2 and a molecular weight of 865.26 g/mol. Its IUPAC name is 10-[10-[9,9-dimethyl-2,7-bis(2-methylbut-3-en-2-yl)acridin-10-yl]anthracen-9-yl]-9,9-dimethyl-2,7-bis(2-methylbut-3-en-2-yl)acridine.
| Compound Name | 10-[10-[9,9-dimethyl-2,7-bis(2-methylbut-3-en-2-yl)acridin-10-yl]anthracen-9-yl]-9,9-dimethyl-2,7-bis(2-methylbut-3-en-2-yl)acridine |
|---|---|
| PubChem CID | 170691771 |
| Molecular Formula | C64H68N2 |
| Molecular Weight | 865.26 g/mol |
| Exact Mass | 864.54 |
| IUPAC Name | 10-[10-[9,9-dimethyl-2,7-bis(2-methylbut-3-en-2-yl)acridin-10-yl]anthracen-9-yl]-9,9-dimethyl-2,7-bis(2-methylbut-3-en-2-yl)acridine |
| SMILES | C=CC(C)(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)C=C)ccc1N2c1c2ccccc2c(N2c3ccc(C(C)(C)C=C)cc3C(C)(C)c3cc(C(C)(C)C=C)ccc32)c2ccccc12 |
| InChI | InChI=1S/C64H68N2/c1-17-59(5,6)41-29-33-53-49(37-41)63(13,14)50-38-42(60(7,8)18-2)30-34-54(50)65(53)57-45-25-21-23-27-47(45)58(48-28-24-22-26-46(48)57)66-55-35-31-43(61(9,10)19-3)39-51(55)64(15,16)52-40-44(32-36-56(52)66)62(11,12)20-4/h17-40H,1-4H2,5-16H3 |
| InChIKey | OCCJSOGDNYUKCU-UHFFFAOYSA-N |
| XLogP | 18.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.26 |
| LogP ≤ 5 | 18.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|