C33H56O — CID 170694557
(1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-2-hexyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 170694557) has the molecular formula C33H56O and a molecular weight of 468.81 g/mol. Its IUPAC name is (1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-2-hexyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-2-hexyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 170694557 |
| Molecular Formula | C33H56O |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.43 |
| IUPAC Name | (1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-2-hexyl-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)C/C1=C\C=C1/CCC[C@@]2(C)[C@H]1CC(CCCCCC)[C@H]2[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C33H56O/c1-7-8-9-10-15-29-23-31-27(18-19-28-22-30(34)20-17-25(28)4)16-12-21-33(31,6)32(29)26(5)14-11-13-24(2)3/h18-19,24,26,29-32,34H,4,7-17,20-23H2,1-3,5-6H3/b27-18+,28-19+/t26-,29?,30+,31+,32-,33+/m1/s1 |
| InChIKey | VCNHEIGGMNNGNN-HYLVLHEESA-N |
| XLogP | 9.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|