C15H29NO — CID 170694966
(Z)-5-(cyclohexylamino)-2,6-dimethylhept-3-en-3-ol (PubChem CID 170694966) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is (Z)-5-(cyclohexylamino)-2,6-dimethylhept-3-en-3-ol.
| Compound Name | (Z)-5-(cyclohexylamino)-2,6-dimethylhept-3-en-3-ol |
|---|---|
| PubChem CID | 170694966 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | (Z)-5-(cyclohexylamino)-2,6-dimethylhept-3-en-3-ol |
| SMILES | CC(C)/C(O)=C/C(NC1CCCCC1)C(C)C |
| InChI | InChI=1S/C15H29NO/c1-11(2)14(10-15(17)12(3)4)16-13-8-6-5-7-9-13/h10-14,16-17H,5-9H2,1-4H3/b15-10- |
| InChIKey | VERNPMBWFFCMEB-GDNBJRDFSA-N |
| XLogP | 4.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|