C19H36O — CID 170695126
4,6,6-tritert-butyl-4-methylcyclohex-2-en-1-ol (PubChem CID 170695126) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is 4,6,6-tritert-butyl-4-methylcyclohex-2-en-1-ol.
| Compound Name | 4,6,6-tritert-butyl-4-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 170695126 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | 4,6,6-tritert-butyl-4-methylcyclohex-2-en-1-ol |
| SMILES | CC(C)(C)C1(C)C=CC(O)C(C(C)(C)C)(C(C)(C)C)C1 |
| InChI | InChI=1S/C19H36O/c1-15(2,3)18(10)12-11-14(20)19(13-18,16(4,5)6)17(7,8)9/h11-12,14,20H,13H2,1-10H3 |
| InChIKey | NSHWKMPXLIKLGG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|