C9H6F3NO3 — CID 170699892
4-ethenyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylic acid (PubChem CID 170699892) has the molecular formula C9H6F3NO3 and a molecular weight of 233.14 g/mol. Its IUPAC name is 4-ethenyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylic acid.
| Compound Name | 4-ethenyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170699892 |
| Molecular Formula | C9H6F3NO3 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 4-ethenyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylic acid |
| SMILES | C=Cc1cc(C(F)(F)F)[nH]c(=O)c1C(=O)O |
| InChI | InChI=1S/C9H6F3NO3/c1-2-4-3-5(9(10,11)12)13-7(14)6(4)8(15)16/h2-3H,1H2,(H,13,14)(H,15,16) |
| InChIKey | YRRUIVKLGGIPJE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |