C23H19F2N3O4 — CID 170700000
4-[2-carbamoyl-4-[4-(2-fluoroprop-2-enoylamino)-2-methylphenyl]-5-methyl-1H-pyrrol-3-yl]-2-fluorobenzoic acid (PubChem CID 170700000) has the molecular formula C23H19F2N3O4 and a molecular weight of 439.42 g/mol. Its IUPAC name is 4-[2-carbamoyl-4-[4-(2-fluoroprop-2-enoylamino)-2-methylphenyl]-5-methyl-1H-pyrrol-3-yl]-2-fluorobenzoic acid.
| Compound Name | 4-[2-carbamoyl-4-[4-(2-fluoroprop-2-enoylamino)-2-methylphenyl]-5-methyl-1H-pyrrol-3-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 170700000 |
| Molecular Formula | C23H19F2N3O4 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 4-[2-carbamoyl-4-[4-(2-fluoroprop-2-enoylamino)-2-methylphenyl]-5-methyl-1H-pyrrol-3-yl]-2-fluorobenzoic acid |
| SMILES | C=C(F)C(=O)Nc1ccc(-c2c(C)[nH]c(C(N)=O)c2-c2ccc(C(=O)O)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C23H19F2N3O4/c1-10-8-14(28-22(30)11(2)24)5-7-15(10)18-12(3)27-20(21(26)29)19(18)13-4-6-16(23(31)32)17(25)9-13/h4-9,27H,2H2,1,3H3,(H2,26,29)(H,28,30)(H,31,32) |
| InChIKey | HUQPJQHXQITBCX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|