About methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate
methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate (PubChem CID 170701241) has the molecular formula C13H9BrF5NO3S
and a molecular weight of 434.18 g/mol. Its IUPAC name is methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate |
| PubChem CID | 170701241 |
| Molecular Formula | C13H9BrF5NO3S |
| Molecular Weight | 434.18 g/mol |
| Exact Mass | 432.94 |
| IUPAC Name | methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(Oc2cccc(S(F)(F)(F)(F)F)c2)c(Br)c1 |
| InChI | InChI=1S/C13H9BrF5NO3S/c1-22-13(21)8-5-11(14)12(20-7-8)23-9-3-2-4-10(6-9)24(15,16,17,18)19/h2-7H,1H3 |
| InChIKey | ICMIWVJNLFNSPE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.18 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate?
The IUPAC name of methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate (CID 170701241) is methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate.
What is the SMILES notation for methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate?
The canonical SMILES for methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate is COC(=O)c1cnc(Oc2cccc(S(F)(F)(F)(F)F)c2)c(Br)c1.
What is the InChIKey of methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate?
The InChIKey is ICMIWVJNLFNSPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrF5NO3S/c1-22-13(21)8-5-11(14)12(20-7-8)23-9-3-2-4-10(6-9)24(15,16,17,18)19/h2-7H,1H3.
What are the key properties of methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate?
methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate has a molecular weight of 434.18 g/mol, XLogP of 6.08, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromo-6-[3-(pentafluoro-λ6-sulfanyl)phenoxy]pyridine-3-carboxylate is sourced from PubChem (CID 170701241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).