C18H16N2O4S2 — CID 170701812
methyl 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-phenylbenzoate (PubChem CID 170701812) has the molecular formula C18H16N2O4S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is methyl 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-phenylbenzoate.
| Compound Name | methyl 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-phenylbenzoate |
|---|---|
| PubChem CID | 170701812 |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | methyl 3-[[2-(aminomethyl)-1,3-thiazol-5-yl]sulfonyl]-5-phenylbenzoate |
| SMILES | COC(=O)c1cc(-c2ccccc2)cc(S(=O)(=O)c2cnc(CN)s2)c1 |
| InChI | InChI=1S/C18H16N2O4S2/c1-24-18(21)14-7-13(12-5-3-2-4-6-12)8-15(9-14)26(22,23)17-11-20-16(10-19)25-17/h2-9,11H,10,19H2,1H3 |
| InChIKey | YNADELKEBJJJJQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |