C32H40O4 — CID 156599569
methyl 3-[4-(3,5-ditert-butylphenoxy)butoxy]-5-phenylbenzoate (PubChem CID 156599569) has the molecular formula C32H40O4 and a molecular weight of 488.67 g/mol. Its IUPAC name is methyl 3-[4-(3,5-ditert-butylphenoxy)butoxy]-5-phenylbenzoate.
| Compound Name | methyl 3-[4-(3,5-ditert-butylphenoxy)butoxy]-5-phenylbenzoate |
|---|---|
| PubChem CID | 156599569 |
| Molecular Formula | C32H40O4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | methyl 3-[4-(3,5-ditert-butylphenoxy)butoxy]-5-phenylbenzoate |
| SMILES | COC(=O)c1cc(OCCCCOc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C32H40O4/c1-31(2,3)26-20-27(32(4,5)6)22-29(21-26)36-16-12-11-15-35-28-18-24(23-13-9-8-10-14-23)17-25(19-28)30(33)34-7/h8-10,13-14,17-22H,11-12,15-16H2,1-7H3 |
| InChIKey | DCEONHHLZPGAAP-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|