C17H22ClFO2 — CID 170702915
(1S,2S,3R,4S)-3-chloro-2-[(2-fluorophenyl)methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane (PubChem CID 170702915) has the molecular formula C17H22ClFO2 and a molecular weight of 312.81 g/mol. Its IUPAC name is (1S,2S,3R,4S)-3-chloro-2-[(2-fluorophenyl)methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,3R,4S)-3-chloro-2-[(2-fluorophenyl)methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 170702915 |
| Molecular Formula | C17H22ClFO2 |
| Molecular Weight | 312.81 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (1S,2S,3R,4S)-3-chloro-2-[(2-fluorophenyl)methoxy]-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane |
| SMILES | CC(C)[C@]12CC[C@](C)(O1)[C@H](OCc1ccccc1F)[C@H]2Cl |
| InChI | InChI=1S/C17H22ClFO2/c1-11(2)17-9-8-16(3,21-17)15(14(17)18)20-10-12-6-4-5-7-13(12)19/h4-7,11,14-15H,8-10H2,1-3H3/t14-,15-,16+,17+/m1/s1 |
| InChIKey | KDAMQJRIMAHTKC-NCOADZHNSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|