C33H39FN6O3 — CID 170704104
1-[3-[[7-(2-cyclopropyl-5-hydroxy-4-methylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 170704104) has the molecular formula C33H39FN6O3 and a molecular weight of 586.71 g/mol. Its IUPAC name is 1-[3-[[7-(2-cyclopropyl-5-hydroxy-4-methylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[7-(2-cyclopropyl-5-hydroxy-4-methylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170704104 |
| Molecular Formula | C33H39FN6O3 |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | 1-[3-[[7-(2-cyclopropyl-5-hydroxy-4-methylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(N(C)c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cc(O)c(C)cc4C4CC4)ncc23)C1 |
| InChI | InChI=1S/C33H39FN6O3/c1-4-27(42)39-14-9-22(18-39)38(3)31-25-17-35-29(24-16-26(41)20(2)15-23(24)21-7-8-21)28(34)30(25)36-32(37-31)43-19-33-10-5-12-40(33)13-6-11-33/h4,15-17,21-22,41H,1,5-14,18-19H2,2-3H3 |
| InChIKey | BKFMPULEYTXSSL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|