C33H40ClFN8O2 — CID 170704282
1-[3-[[7-(5-chloro-6-methyl-1H-indazol-4-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidin-1-yl]prop-2-en-1-one;2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 170704282) has the molecular formula C33H40ClFN8O2 and a molecular weight of 635.19 g/mol. Its IUPAC name is 1-[3-[[7-(5-chloro-6-methyl-1H-indazol-4-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidin-1-yl]prop-2-en-1-one;2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 1-[3-[[7-(5-chloro-6-methyl-1H-indazol-4-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidin-1-yl]prop-2-en-1-one;2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 170704282 |
| Molecular Formula | C33H40ClFN8O2 |
| Molecular Weight | 635.19 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | 1-[3-[[7-(5-chloro-6-methyl-1H-indazol-4-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl]-methylamino]pyrrolidin-1-yl]prop-2-en-1-one;2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | C=CC(=O)N1CCC(N(C)c2nc(OC)nc3c(F)c(-c4c(Cl)c(C)cc5[nH]ncc45)ncc23)C1.CC1CN2CCCC2(C)C1 |
| InChI | InChI=1S/C24H23ClFN7O2.C9H17N/c1-5-17(34)33-7-6-13(11-33)32(3)23-15-9-27-22(20(26)21(15)29-24(30-23)35-4)18-14-10-28-31-16(14)8-12(2)19(18)25;1-8-6-9(2)4-3-5-10(9)7-8/h5,8-10,13H,1,6-7,11H2,2-4H3,(H,28,31);8H,3-7H2,1-2H3 |
| InChIKey | KYTVCJFNDJFFQP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.19 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|