About 1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane
1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane (PubChem CID 170705000) has the molecular formula C14H30O
and a molecular weight of 214.39 g/mol. Its IUPAC name is 1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane.
Analyze 1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane?
The IUPAC name of 1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane (CID 170705000) is 1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane.
What is the SMILES notation for 1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane?
The canonical SMILES for 1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane is CC(C)C(C)(C)CCOC(C)(C)C(C)C.
What is the InChIKey of 1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane?
The InChIKey is OSXUZLBTLHOWIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O/c1-11(2)13(5,6)9-10-15-14(7,8)12(3)4/h11-12H,9-10H2,1-8H3.
What are the key properties of 1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane?
1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane has a molecular weight of 214.39 g/mol, XLogP of 4.51, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethylbutan-2-yloxy)-3,3,4-trimethylpentane is sourced from PubChem (CID 170705000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).