C19H40O2 — CID 139690898
2,2,6,6,7-pentamethyl-3,3-dipropoxyoctane (PubChem CID 139690898) has the molecular formula C19H40O2 and a molecular weight of 300.53 g/mol. Its IUPAC name is 2,2,6,6,7-pentamethyl-3,3-dipropoxyoctane.
| Compound Name | 2,2,6,6,7-pentamethyl-3,3-dipropoxyoctane |
|---|---|
| PubChem CID | 139690898 |
| Molecular Formula | C19H40O2 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.30 |
| IUPAC Name | 2,2,6,6,7-pentamethyl-3,3-dipropoxyoctane |
| SMILES | CCCOC(CCC(C)(C)C(C)C)(OCCC)C(C)(C)C |
| InChI | InChI=1S/C19H40O2/c1-10-14-20-19(17(5,6)7,21-15-11-2)13-12-18(8,9)16(3)4/h16H,10-15H2,1-9H3 |
| InChIKey | TUBZRLUXHLBWJB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|