C36H43N5O3S — CID 170705450
N-[5-methyl-4-[1-[(2E)-3-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]-2,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]-2-[3-(3-piperazin-1-ylpropoxy)phenyl]acetamide (PubChem CID 170705450) has the molecular formula C36H43N5O3S and a molecular weight of 625.84 g/mol. Its IUPAC name is N-[5-methyl-4-[1-[(2E)-3-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]-2,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]-2-[3-(3-piperazin-1-ylpropoxy)phenyl]acetamide.
| Compound Name | N-[5-methyl-4-[1-[(2E)-3-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]-2,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]-2-[3-(3-piperazin-1-ylpropoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 170705450 |
| Molecular Formula | C36H43N5O3S |
| Molecular Weight | 625.84 g/mol |
| Exact Mass | 625.31 |
| IUPAC Name | N-[5-methyl-4-[1-[(2E)-3-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienoyl]-2,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]-2-[3-(3-piperazin-1-ylpropoxy)phenyl]acetamide |
| SMILES | C=C/C(C)=C(\C=C/C)C(=O)N1CCc2cc(-c3nc(NC(=O)Cc4cccc(OCCCN5CCNCC5)c4)sc3C)ccc21 |
| InChI | InChI=1S/C36H43N5O3S/c1-5-9-31(25(3)6-2)35(43)41-18-14-28-24-29(12-13-32(28)41)34-26(4)45-36(39-34)38-33(42)23-27-10-7-11-30(22-27)44-21-8-17-40-19-15-37-16-20-40/h5-7,9-13,22,24,37H,2,8,14-21,23H2,1,3-4H3,(H,38,39,42)/b9-5-,31-25+ |
| InChIKey | SGVNZFZEKLSQPK-SISUVNBXSA-N |
| XLogP | 5.94 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.84 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|