C23H26ClN5O2S — CID 24830407
N-[4-(2-chloro-4-pyridinyl)-1,3-thiazol-2-yl]-2-[3-(3-piperazin-1-ylpropoxy)phenyl]acetamide (PubChem CID 24830407) has the molecular formula C23H26ClN5O2S and a molecular weight of 472.01 g/mol. Its IUPAC name is N-[4-(2-chloro-4-pyridinyl)-1,3-thiazol-2-yl]-2-[3-(3-piperazin-1-ylpropoxy)phenyl]acetamide.
| Compound Name | N-[4-(2-chloro-4-pyridinyl)-1,3-thiazol-2-yl]-2-[3-(3-piperazin-1-ylpropoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 24830407 |
| Molecular Formula | C23H26ClN5O2S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[4-(2-chloro-4-pyridinyl)-1,3-thiazol-2-yl]-2-[3-(3-piperazin-1-ylpropoxy)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(OCCCN2CCNCC2)c1)Nc1nc(-c2ccnc(Cl)c2)cs1 |
| InChI | InChI=1S/C23H26ClN5O2S/c24-21-15-18(5-6-26-21)20-16-32-23(27-20)28-22(30)14-17-3-1-4-19(13-17)31-12-2-9-29-10-7-25-8-11-29/h1,3-6,13,15-16,25H,2,7-12,14H2,(H,27,28,30) |
| InChIKey | RLSRPOHERDYBAG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|