C24H28ClN5OS — CID 87106859
N-[4-(2-chloro-4-pyridinyl)-1,3-thiazol-2-yl]-2-[3-(4-piperazin-1-ylbutyl)phenyl]acetamide (PubChem CID 87106859) has the molecular formula C24H28ClN5OS and a molecular weight of 470.04 g/mol. Its IUPAC name is N-[4-(2-chloro-4-pyridinyl)-1,3-thiazol-2-yl]-2-[3-(4-piperazin-1-ylbutyl)phenyl]acetamide.
| Compound Name | N-[4-(2-chloro-4-pyridinyl)-1,3-thiazol-2-yl]-2-[3-(4-piperazin-1-ylbutyl)phenyl]acetamide |
|---|---|
| PubChem CID | 87106859 |
| Molecular Formula | C24H28ClN5OS |
| Molecular Weight | 470.04 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-[4-(2-chloro-4-pyridinyl)-1,3-thiazol-2-yl]-2-[3-(4-piperazin-1-ylbutyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(CCCCN2CCNCC2)c1)Nc1nc(-c2ccnc(Cl)c2)cs1 |
| InChI | InChI=1S/C24H28ClN5OS/c25-22-16-20(7-8-27-22)21-17-32-24(28-21)29-23(31)15-19-6-3-5-18(14-19)4-1-2-11-30-12-9-26-10-13-30/h3,5-8,14,16-17,26H,1-2,4,9-13,15H2,(H,28,29,31) |
| InChIKey | SVYSMUZZNXFNFI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.04 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|