C31H43N5OS2 — CID 168950451
6-(4-methylpiperazin-1-yl)-N-[4-[3-[(4-pentylphenyl)sulfanylamino]phenyl]-1,3-thiazol-2-yl]hexanamide (PubChem CID 168950451) has the molecular formula C31H43N5OS2 and a molecular weight of 565.85 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)-N-[4-[3-[(4-pentylphenyl)sulfanylamino]phenyl]-1,3-thiazol-2-yl]hexanamide.
| Compound Name | 6-(4-methylpiperazin-1-yl)-N-[4-[3-[(4-pentylphenyl)sulfanylamino]phenyl]-1,3-thiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 168950451 |
| Molecular Formula | C31H43N5OS2 |
| Molecular Weight | 565.85 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)-N-[4-[3-[(4-pentylphenyl)sulfanylamino]phenyl]-1,3-thiazol-2-yl]hexanamide |
| SMILES | CCCCCc1ccc(SNc2cccc(-c3csc(NC(=O)CCCCCN4CCN(C)CC4)n3)c2)cc1 |
| InChI | InChI=1S/C31H43N5OS2/c1-3-4-6-10-25-14-16-28(17-15-25)39-34-27-12-9-11-26(23-27)29-24-38-31(32-29)33-30(37)13-7-5-8-18-36-21-19-35(2)20-22-36/h9,11-12,14-17,23-24,34H,3-8,10,13,18-22H2,1-2H3,(H,32,33,37) |
| InChIKey | KWAKRIGPRPBTQN-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.85 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|