C26H26N4O3S2 — CID 168950480
5-[[4-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]phenyl]-1,3-thiazol-2-yl]amino]-5-oxopentanoic acid (PubChem CID 168950480) has the molecular formula C26H26N4O3S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 5-[[4-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]phenyl]-1,3-thiazol-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[4-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]phenyl]-1,3-thiazol-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168950480 |
| Molecular Formula | C26H26N4O3S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 5-[[4-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]phenyl]-1,3-thiazol-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CN(C)c1cccc2c(SNc3cccc(-c4csc(NC(=O)CCCC(=O)O)n4)c3)cccc12 |
| InChI | InChI=1S/C26H26N4O3S2/c1-30(2)22-11-4-10-20-19(22)9-5-12-23(20)35-29-18-8-3-7-17(15-18)21-16-34-26(27-21)28-24(31)13-6-14-25(32)33/h3-5,7-12,15-16,29H,6,13-14H2,1-2H3,(H,32,33)(H,27,28,31) |
| InChIKey | YOJLMGVEENEWOH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|