C25H27N5O4S2 — CID 168950503
N-[4-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]phenyl]-1,3-thiazol-2-yl]-2-(2-hydroxyethylamino)acetamide (PubChem CID 168950503) has the molecular formula C25H27N5O4S2 and a molecular weight of 525.66 g/mol. Its IUPAC name is N-[4-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]phenyl]-1,3-thiazol-2-yl]-2-(2-hydroxyethylamino)acetamide.
| Compound Name | N-[4-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]phenyl]-1,3-thiazol-2-yl]-2-(2-hydroxyethylamino)acetamide |
|---|---|
| PubChem CID | 168950503 |
| Molecular Formula | C25H27N5O4S2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | N-[4-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]phenyl]-1,3-thiazol-2-yl]-2-(2-hydroxyethylamino)acetamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)Nc3cccc(-c4csc(NC(=O)CNCCO)n4)c3)cccc12 |
| InChI | InChI=1S/C25H27N5O4S2/c1-30(2)22-10-4-9-20-19(22)8-5-11-23(20)36(33,34)29-18-7-3-6-17(14-18)21-16-35-25(27-21)28-24(32)15-26-12-13-31/h3-11,14,16,26,29,31H,12-13,15H2,1-2H3,(H,27,28,32) |
| InChIKey | CIOFWQKZZDUTEL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|