C28H24N4O4S2 — CID 175291257
[3-(2-benzamido-1,3-thiazol-4-yl)phenyl]-[5-(dimethylamino)naphthalen-1-yl]sulfamic acid (PubChem CID 175291257) has the molecular formula C28H24N4O4S2 and a molecular weight of 544.66 g/mol. Its IUPAC name is [3-(2-benzamido-1,3-thiazol-4-yl)phenyl]-[5-(dimethylamino)naphthalen-1-yl]sulfamic acid.
| Compound Name | [3-(2-benzamido-1,3-thiazol-4-yl)phenyl]-[5-(dimethylamino)naphthalen-1-yl]sulfamic acid |
|---|---|
| PubChem CID | 175291257 |
| Molecular Formula | C28H24N4O4S2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | [3-(2-benzamido-1,3-thiazol-4-yl)phenyl]-[5-(dimethylamino)naphthalen-1-yl]sulfamic acid |
| SMILES | CN(C)c1cccc2c(N(c3cccc(-c4csc(NC(=O)c5ccccc5)n4)c3)S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C28H24N4O4S2/c1-31(2)25-15-7-14-23-22(25)13-8-16-26(23)32(38(34,35)36)21-12-6-11-20(17-21)24-18-37-28(29-24)30-27(33)19-9-4-3-5-10-19/h3-18H,1-2H3,(H,29,30,33)(H,34,35,36) |
| InChIKey | SCHAUPRAINBUAM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|