C20H18N4O5S2 — CID 41363905
4-[cyclopropyl(methyl)sulfamoyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 41363905) has the molecular formula C20H18N4O5S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is 4-[cyclopropyl(methyl)sulfamoyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-[cyclopropyl(methyl)sulfamoyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 41363905 |
| Molecular Formula | C20H18N4O5S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 4-[cyclopropyl(methyl)sulfamoyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CN(C1CC1)S(=O)(=O)c1ccc(C(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)cc1 |
| InChI | InChI=1S/C20H18N4O5S2/c1-23(15-7-8-15)31(28,29)17-9-5-13(6-10-17)19(25)22-20-21-18(12-30-20)14-3-2-4-16(11-14)24(26)27/h2-6,9-12,15H,7-8H2,1H3,(H,21,22,25) |
| InChIKey | IFIIHBYBRVRKCM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|