C30H35N5O3S2 — CID 168950489
tert-butyl N-[4-[[4-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]phenyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]carbamate (PubChem CID 168950489) has the molecular formula C30H35N5O3S2 and a molecular weight of 577.78 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]phenyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]phenyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 168950489 |
| Molecular Formula | C30H35N5O3S2 |
| Molecular Weight | 577.78 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | tert-butyl N-[4-[[4-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]phenyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]carbamate |
| SMILES | CN(C)c1cccc2c(SNc3cccc(-c4csc(NC(=O)CCCNC(=O)OC(C)(C)C)n4)c3)cccc12 |
| InChI | InChI=1S/C30H35N5O3S2/c1-30(2,3)38-29(37)31-17-9-16-27(36)33-28-32-24(19-39-28)20-10-6-11-21(18-20)34-40-26-15-8-12-22-23(26)13-7-14-25(22)35(4)5/h6-8,10-15,18-19,34H,9,16-17H2,1-5H3,(H,31,37)(H,32,33,36) |
| InChIKey | GHGFTULCMLJHAJ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.78 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|