C28H37N5O2S2 — CID 168950436
2-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-[3-[(4-pentylphenyl)sulfanylamino]phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 168950436) has the molecular formula C28H37N5O2S2 and a molecular weight of 539.77 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-[3-[(4-pentylphenyl)sulfanylamino]phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-[3-[(4-pentylphenyl)sulfanylamino]phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 168950436 |
| Molecular Formula | C28H37N5O2S2 |
| Molecular Weight | 539.77 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-[3-[(4-pentylphenyl)sulfanylamino]phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CCCCCc1ccc(SNc2cccc(-c3csc(NC(=O)CN4CCN(CCO)CC4)n3)c2)cc1 |
| InChI | InChI=1S/C28H37N5O2S2/c1-2-3-4-6-22-9-11-25(12-10-22)37-31-24-8-5-7-23(19-24)26-21-36-28(29-26)30-27(35)20-33-15-13-32(14-16-33)17-18-34/h5,7-12,19,21,31,34H,2-4,6,13-18,20H2,1H3,(H,29,30,35) |
| InChIKey | XYQHRVLPSPWGMD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.77 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|