C29H39N5O5S2 — CID 168859172
2-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-[4-methoxy-3-[(4-pentylphenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 168859172) has the molecular formula C29H39N5O5S2 and a molecular weight of 601.80 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-[4-methoxy-3-[(4-pentylphenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-[4-methoxy-3-[(4-pentylphenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 168859172 |
| Molecular Formula | C29H39N5O5S2 |
| Molecular Weight | 601.80 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-[4-methoxy-3-[(4-pentylphenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)Nc2cc(-c3csc(NC(=O)CN4CCN(CCO)CC4)n3)ccc2OC)cc1 |
| InChI | InChI=1S/C29H39N5O5S2/c1-3-4-5-6-22-7-10-24(11-8-22)41(37,38)32-25-19-23(9-12-27(25)39-2)26-21-40-29(30-26)31-28(36)20-34-15-13-33(14-16-34)17-18-35/h7-12,19,21,32,35H,3-6,13-18,20H2,1-2H3,(H,30,31,36) |
| InChIKey | MOGIVGLPQBTBRW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.80 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|