C27H41N5O2S — CID 59421414
N-[4-(5-hexyl-2-methoxyphenyl)-1,3-thiazol-2-yl]-4-(2-pyrrolidin-1-ylethyl)piperazine-1-carboxamide (PubChem CID 59421414) has the molecular formula C27H41N5O2S and a molecular weight of 499.73 g/mol. Its IUPAC name is N-[4-(5-hexyl-2-methoxyphenyl)-1,3-thiazol-2-yl]-4-(2-pyrrolidin-1-ylethyl)piperazine-1-carboxamide.
| Compound Name | N-[4-(5-hexyl-2-methoxyphenyl)-1,3-thiazol-2-yl]-4-(2-pyrrolidin-1-ylethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 59421414 |
| Molecular Formula | C27H41N5O2S |
| Molecular Weight | 499.73 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | N-[4-(5-hexyl-2-methoxyphenyl)-1,3-thiazol-2-yl]-4-(2-pyrrolidin-1-ylethyl)piperazine-1-carboxamide |
| SMILES | CCCCCCc1ccc(OC)c(-c2csc(NC(=O)N3CCN(CCN4CCCC4)CC3)n2)c1 |
| InChI | InChI=1S/C27H41N5O2S/c1-3-4-5-6-9-22-10-11-25(34-2)23(20-22)24-21-35-26(28-24)29-27(33)32-18-16-31(17-19-32)15-14-30-12-7-8-13-30/h10-11,20-21H,3-9,12-19H2,1-2H3,(H,28,29,33) |
| InChIKey | NSYKYONHOXTEIR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.73 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|