C32H45N5O4S2 — CID 176652779
6-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-[3-[(4-pentylphenyl)sulfamoyl]phenyl]-1,3-thiazol-2-yl]hexanamide (PubChem CID 176652779) has the molecular formula C32H45N5O4S2 and a molecular weight of 627.88 g/mol. Its IUPAC name is 6-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-[3-[(4-pentylphenyl)sulfamoyl]phenyl]-1,3-thiazol-2-yl]hexanamide.
| Compound Name | 6-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-[3-[(4-pentylphenyl)sulfamoyl]phenyl]-1,3-thiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 176652779 |
| Molecular Formula | C32H45N5O4S2 |
| Molecular Weight | 627.88 g/mol |
| Exact Mass | 627.29 |
| IUPAC Name | 6-[4-(2-hydroxyethyl)piperazin-1-yl]-N-[4-[3-[(4-pentylphenyl)sulfamoyl]phenyl]-1,3-thiazol-2-yl]hexanamide |
| SMILES | CCCCCc1ccc(NS(=O)(=O)c2cccc(-c3csc(NC(=O)CCCCCN4CCN(CCO)CC4)n3)c2)cc1 |
| InChI | InChI=1S/C32H45N5O4S2/c1-2-3-5-9-26-13-15-28(16-14-26)35-43(40,41)29-11-8-10-27(24-29)30-25-42-32(33-30)34-31(39)12-6-4-7-17-36-18-20-37(21-19-36)22-23-38/h8,10-11,13-16,24-25,35,38H,2-7,9,12,17-23H2,1H3,(H,33,34,39) |
| InChIKey | OGBVKQAPNYIQIW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.88 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|