C21H29N3O3S2 — CID 134065017
2-[2-(azepan-1-yl)ethylsulfanyl]-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 134065017) has the molecular formula C21H29N3O3S2 and a molecular weight of 435.62 g/mol. Its IUPAC name is 2-[2-(azepan-1-yl)ethylsulfanyl]-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[2-(azepan-1-yl)ethylsulfanyl]-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 134065017 |
| Molecular Formula | C21H29N3O3S2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-[2-(azepan-1-yl)ethylsulfanyl]-N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2csc(NC(=O)CSCCN3CCCCCC3)n2)cc1OC |
| InChI | InChI=1S/C21H29N3O3S2/c1-26-18-8-7-16(13-19(18)27-2)17-14-29-21(22-17)23-20(25)15-28-12-11-24-9-5-3-4-6-10-24/h7-8,13-14H,3-6,9-12,15H2,1-2H3,(H,22,23,25) |
| InChIKey | GLLBZCSUHXQPQH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|